C14H19NO5S — CID 63911633
methyl 2-[4-[(1,1-dioxothian-3-yl)amino]phenoxy]acetate (PubChem CID 63911633) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 2-[4-[(1,1-dioxothian-3-yl)amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(1,1-dioxothian-3-yl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 63911633 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | methyl 2-[4-[(1,1-dioxothian-3-yl)amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC2CCCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H19NO5S/c1-19-14(16)9-20-13-6-4-11(5-7-13)15-12-3-2-8-21(17,18)10-12/h4-7,12,15H,2-3,8-10H2,1H3 |
| InChIKey | NTWCKTPQIYPEPS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|