C11H16N2O4S2 — CID 63908905
4-[(1,1-dioxothian-3-yl)amino]benzenesulfonamide (PubChem CID 63908905) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-3-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(1,1-dioxothian-3-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 63908905 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-[(1,1-dioxothian-3-yl)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC2CCCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H16N2O4S2/c12-19(16,17)11-5-3-9(4-6-11)13-10-2-1-7-18(14,15)8-10/h3-6,10,13H,1-2,7-8H2,(H2,12,16,17) |
| InChIKey | NLNDMXQIESDRRC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |