C11H15NO4S2 — CID 24693954
N-(4-methylsulfonylphenyl)-1,1-dioxothiolan-3-amine (PubChem CID 24693954) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(4-methylsulfonylphenyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 24693954 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-1,1-dioxothiolan-3-amine |
| SMILES | CS(=O)(=O)c1ccc(NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H15NO4S2/c1-17(13,14)11-4-2-9(3-5-11)12-10-6-7-18(15,16)8-10/h2-5,10,12H,6-8H2,1H3 |
| InChIKey | PKWASUBLMCOVRL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |