C13H17NO5S2 — CID 110771301
N-(1,1-dioxothiolan-3-yl)-2-(4-methylsulfonylphenyl)acetamide (PubChem CID 110771301) has the molecular formula C13H17NO5S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(4-methylsulfonylphenyl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 110771301 |
| Molecular Formula | C13H17NO5S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(4-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H17NO5S2/c1-20(16,17)12-4-2-10(3-5-12)8-13(15)14-11-6-7-21(18,19)9-11/h2-5,11H,6-9H2,1H3,(H,14,15) |
| InChIKey | KWUIFVOBJRCIDO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |