C13H16N2O7S2 — CID 110407099
2-(1,3-benzodioxol-5-ylsulfonylamino)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 110407099) has the molecular formula C13H16N2O7S2 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylsulfonylamino)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylsulfonylamino)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 110407099 |
| Molecular Formula | C13H16N2O7S2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylsulfonylamino)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc2c(c1)OCO2)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16N2O7S2/c16-13(15-9-3-4-23(17,18)7-9)6-14-24(19,20)10-1-2-11-12(5-10)22-8-21-11/h1-2,5,9,14H,3-4,6-8H2,(H,15,16) |
| InChIKey | VMEBZXZKHNUZBQ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |