C9H8NO6S- — CID 7744996
2-(1,3-benzodioxol-5-ylsulfonylamino)acetate (PubChem CID 7744996) has the molecular formula C9H8NO6S- and a molecular weight of 258.23 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylsulfonylamino)acetate.
| Compound Name | 2-(1,3-benzodioxol-5-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 7744996 |
| Molecular Formula | C9H8NO6S- |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylsulfonylamino)acetate |
| SMILES | O=C([O-])CNS(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H9NO6S/c11-9(12)4-10-17(13,14)6-1-2-7-8(3-6)16-5-15-7/h1-3,10H,4-5H2,(H,11,12)/p-1 |
| InChIKey | MWOPDRHJEXUACB-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |