C14H19ClN2O5S2 — CID 18274802
2-[(4-chlorophenyl)sulfonyl-ethylamino]-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 18274802) has the molecular formula C14H19ClN2O5S2 and a molecular weight of 394.90 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-ethylamino]-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-ethylamino]-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 18274802 |
| Molecular Formula | C14H19ClN2O5S2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-ethylamino]-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CCN(CC(=O)NC1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O5S2/c1-2-17(24(21,22)13-5-3-11(15)4-6-13)9-14(18)16-12-7-8-23(19,20)10-12/h3-6,12H,2,7-10H2,1H3,(H,16,18) |
| InChIKey | JUHXRBYFGUNOOR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |