C17H24N2O5S2 — CID 42902865
2-[(3,4-dimethylphenyl)sulfonyl-prop-2-enylamino]-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 42902865) has the molecular formula C17H24N2O5S2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)sulfonyl-prop-2-enylamino]-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-[(3,4-dimethylphenyl)sulfonyl-prop-2-enylamino]-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 42902865 |
| Molecular Formula | C17H24N2O5S2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)sulfonyl-prop-2-enylamino]-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | C=CCN(CC(=O)NC1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H24N2O5S2/c1-4-8-19(11-17(20)18-15-7-9-25(21,22)12-15)26(23,24)16-6-5-13(2)14(3)10-16/h4-6,10,15H,1,7-9,11-12H2,2-3H3,(H,18,20) |
| InChIKey | BFOUVWMRNVAYOA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|