C17H24N2O3S — CID 51097266
N-(1,1-dioxothiolan-3-yl)-2-[2-phenylethyl(prop-2-enyl)amino]acetamide (PubChem CID 51097266) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[2-phenylethyl(prop-2-enyl)amino]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[2-phenylethyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 51097266 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[2-phenylethyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(CCc1ccccc1)CC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N2O3S/c1-2-10-19(11-8-15-6-4-3-5-7-15)13-17(20)18-16-9-12-23(21,22)14-16/h2-7,16H,1,8-14H2,(H,18,20) |
| InChIKey | QHDLZVSCENEBGZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|