C16H22N2O4S — CID 113118228
3-[acetyl(benzyl)amino]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 113118228) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-[acetyl(benzyl)amino]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[acetyl(benzyl)amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 113118228 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3-[acetyl(benzyl)amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CC(=O)N(CCC(=O)NC1CCS(=O)(=O)C1)Cc1ccccc1 |
| InChI | InChI=1S/C16H22N2O4S/c1-13(19)18(11-14-5-3-2-4-6-14)9-7-16(20)17-15-8-10-23(21,22)12-15/h2-6,15H,7-12H2,1H3,(H,17,20) |
| InChIKey | CZESSHGJIAJWEQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |