C17H22N2O5S — CID 113130668
3-(N,3-diacetylanilino)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 113130668) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-(N,3-diacetylanilino)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-(N,3-diacetylanilino)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 113130668 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-(N,3-diacetylanilino)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CC(=O)c1cccc(N(CCC(=O)NC2CCS(=O)(=O)C2)C(C)=O)c1 |
| InChI | InChI=1S/C17H22N2O5S/c1-12(20)14-4-3-5-16(10-14)19(13(2)21)8-6-17(22)18-15-7-9-25(23,24)11-15/h3-5,10,15H,6-9,11H2,1-2H3,(H,18,22) |
| InChIKey | NOKGQOIPIOBJJG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |