C15H19N3O5S — CID 51718598
N-(3-acetylphenyl)-2-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]acetamide (PubChem CID 51718598) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]acetamide |
|---|---|
| PubChem CID | 51718598 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-(3-acetylphenyl)-2-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CNC(=O)N[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H19N3O5S/c1-10(19)11-3-2-4-12(7-11)17-14(20)8-16-15(21)18-13-5-6-24(22,23)9-13/h2-4,7,13H,5-6,8-9H2,1H3,(H,17,20)(H2,16,18,21)/t13-/m0/s1 |
| InChIKey | ZRYSFHSRCWGBBP-ZDUSSCGKSA-N |
| XLogP | 0.31 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |