C12H16N4O4S — CID 51716988
2-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]-N-pyridin-3-ylacetamide (PubChem CID 51716988) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 51716988 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]-N-pyridin-3-ylacetamide |
| SMILES | O=C(CNC(=O)N[C@@H]1CCS(=O)(=O)C1)Nc1cccnc1 |
| InChI | InChI=1S/C12H16N4O4S/c17-11(15-9-2-1-4-13-6-9)7-14-12(18)16-10-3-5-21(19,20)8-10/h1-2,4,6,10H,3,5,7-8H2,(H,15,17)(H2,14,16,18)/t10-/m1/s1 |
| InChIKey | HRUIAPLYTZQCAN-SNVBAGLBSA-N |
| XLogP | -0.49 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |