C18H20N4O4S — CID 42655880
3-[(1,1-dioxothiolan-3-yl)carbamoylamino]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 42655880) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)carbamoylamino]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)carbamoylamino]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42655880 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)carbamoylamino]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(Nc1cccc(C(=O)NCc2cccnc2)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H20N4O4S/c23-17(20-11-13-3-2-7-19-10-13)14-4-1-5-15(9-14)21-18(24)22-16-6-8-27(25,26)12-16/h1-5,7,9-10,16H,6,8,11-12H2,(H,20,23)(H2,21,22,24) |
| InChIKey | DVGFEYYQMNJTGM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |