C19H27N3O4S — CID 42653331
N-cycloheptyl-3-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzamide (PubChem CID 42653331) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-cycloheptyl-3-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzamide.
| Compound Name | N-cycloheptyl-3-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42653331 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-cycloheptyl-3-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)NC2CCCCCC2)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H27N3O4S/c23-18(20-15-7-3-1-2-4-8-15)14-6-5-9-16(12-14)21-19(24)22-17-10-11-27(25,26)13-17/h5-6,9,12,15,17H,1-4,7-8,10-11,13H2,(H,20,23)(H2,21,22,24) |
| InChIKey | FOSOHKZGTYTUGL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |