C18H17ClFN3O4S — CID 39354742
N-(3-chloro-4-fluorophenyl)-3-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]benzamide (PubChem CID 39354742) has the molecular formula C18H17ClFN3O4S and a molecular weight of 425.87 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]benzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 39354742 |
| Molecular Formula | C18H17ClFN3O4S |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2ccc(F)c(Cl)c2)c1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H17ClFN3O4S/c19-15-9-13(4-5-16(15)20)21-17(24)11-2-1-3-12(8-11)22-18(25)23-14-6-7-28(26,27)10-14/h1-5,8-9,14H,6-7,10H2,(H,21,24)(H2,22,23,25)/t14-/m1/s1 |
| InChIKey | XEHOBSGWFVRYSR-CQSZACIVSA-N |
| XLogP | 3.04 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |