C16H17N3O5S2 — CID 25329934
3-[[(3S)-1,1-dioxothiolan-3-yl]sulfamoyl]-N-pyridin-3-ylbenzamide (PubChem CID 25329934) has the molecular formula C16H17N3O5S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[[(3S)-1,1-dioxothiolan-3-yl]sulfamoyl]-N-pyridin-3-ylbenzamide.
| Compound Name | 3-[[(3S)-1,1-dioxothiolan-3-yl]sulfamoyl]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 25329934 |
| Molecular Formula | C16H17N3O5S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 3-[[(3S)-1,1-dioxothiolan-3-yl]sulfamoyl]-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1cccc(S(=O)(=O)N[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C16H17N3O5S2/c20-16(18-13-4-2-7-17-10-13)12-3-1-5-15(9-12)26(23,24)19-14-6-8-25(21,22)11-14/h1-5,7,9-10,14,19H,6,8,11H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | BIYKGWQMGNOQCT-AWEZNQCLSA-N |
| XLogP | 0.80 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |