C17H18N4O4S — CID 74249952
3-[(2-oxopiperidin-3-yl)sulfamoyl]-N-pyridin-3-ylbenzamide (PubChem CID 74249952) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 3-[(2-oxopiperidin-3-yl)sulfamoyl]-N-pyridin-3-ylbenzamide.
| Compound Name | 3-[(2-oxopiperidin-3-yl)sulfamoyl]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 74249952 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-[(2-oxopiperidin-3-yl)sulfamoyl]-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1cccc(S(=O)(=O)NC2CCCNC2=O)c1 |
| InChI | InChI=1S/C17H18N4O4S/c22-16(20-13-5-2-8-18-11-13)12-4-1-6-14(10-12)26(24,25)21-15-7-3-9-19-17(15)23/h1-2,4-6,8,10-11,15,21H,3,7,9H2,(H,19,23)(H,20,22) |
| InChIKey | BQKIHNOGHLTBIM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |