C18H20N2O5S3 — CID 24536263
3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(3-methylsulfanylphenyl)benzamide (PubChem CID 24536263) has the molecular formula C18H20N2O5S3 and a molecular weight of 440.57 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(3-methylsulfanylphenyl)benzamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(3-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 24536263 |
| Molecular Formula | C18H20N2O5S3 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(3-methylsulfanylphenyl)benzamide |
| SMILES | CSc1cccc(NC(=O)c2cccc(S(=O)(=O)NC3CCS(=O)(=O)C3)c2)c1 |
| InChI | InChI=1S/C18H20N2O5S3/c1-26-16-6-3-5-14(11-16)19-18(21)13-4-2-7-17(10-13)28(24,25)20-15-8-9-27(22,23)12-15/h2-7,10-11,15,20H,8-9,12H2,1H3,(H,19,21) |
| InChIKey | UKGOQGYJUYNEHW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |