C20H24N2O5S2 — CID 22829683
3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(2-propan-2-ylphenyl)benzamide (PubChem CID 22829683) has the molecular formula C20H24N2O5S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(2-propan-2-ylphenyl)benzamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(2-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 22829683 |
| Molecular Formula | C20H24N2O5S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(2-propan-2-ylphenyl)benzamide |
| SMILES | CC(C)c1ccccc1NC(=O)c1cccc(S(=O)(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C20H24N2O5S2/c1-14(2)18-8-3-4-9-19(18)21-20(23)15-6-5-7-17(12-15)29(26,27)22-16-10-11-28(24,25)13-16/h3-9,12,14,16,22H,10-11,13H2,1-2H3,(H,21,23) |
| InChIKey | XYHQHNVAWIYWIN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |