C12H17NO5S2 — CID 43507358
N-(1,1-dioxothiolan-3-yl)-3-(1-hydroxyethyl)benzenesulfonamide (PubChem CID 43507358) has the molecular formula C12H17NO5S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(1-hydroxyethyl)benzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(1-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43507358 |
| Molecular Formula | C12H17NO5S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(1-hydroxyethyl)benzenesulfonamide |
| SMILES | CC(O)c1cccc(S(=O)(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H17NO5S2/c1-9(14)10-3-2-4-12(7-10)20(17,18)13-11-5-6-19(15,16)8-11/h2-4,7,9,11,13-14H,5-6,8H2,1H3 |
| InChIKey | IIKIIKHQAMFGAI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |