C12H15ClN2O5S2 — CID 2810894
N-[2-chloro-4-[(1,1-dioxothiolan-3-yl)sulfamoyl]phenyl]acetamide (PubChem CID 2810894) has the molecular formula C12H15ClN2O5S2 and a molecular weight of 366.85 g/mol. Its IUPAC name is N-[2-chloro-4-[(1,1-dioxothiolan-3-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-chloro-4-[(1,1-dioxothiolan-3-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2810894 |
| Molecular Formula | C12H15ClN2O5S2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N-[2-chloro-4-[(1,1-dioxothiolan-3-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O5S2/c1-8(16)14-12-3-2-10(6-11(12)13)22(19,20)15-9-4-5-21(17,18)7-9/h2-3,6,9,15H,4-5,7H2,1H3,(H,14,16) |
| InChIKey | WWOUNFGXEZLDJW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |