C12H14N2O4S2 — CID 106832865
4-cyano-N-(1,1-dioxothiolan-3-yl)-3-methylbenzenesulfonamide (PubChem CID 106832865) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-cyano-N-(1,1-dioxothiolan-3-yl)-3-methylbenzenesulfonamide.
| Compound Name | 4-cyano-N-(1,1-dioxothiolan-3-yl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106832865 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-cyano-N-(1,1-dioxothiolan-3-yl)-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCS(=O)(=O)C2)ccc1C#N |
| InChI | InChI=1S/C12H14N2O4S2/c1-9-6-12(3-2-10(9)7-13)20(17,18)14-11-4-5-19(15,16)8-11/h2-3,6,11,14H,4-5,8H2,1H3 |
| InChIKey | VZPAZXLNUTYFOK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |