C11H14N2O6S2 — CID 2876523
N-(1,1-dioxothiolan-3-yl)-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 2876523) has the molecular formula C11H14N2O6S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2876523 |
| Molecular Formula | C11H14N2O6S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCS(=O)(=O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N2O6S2/c1-8-2-3-10(6-11(8)13(14)15)21(18,19)12-9-4-5-20(16,17)7-9/h2-3,6,9,12H,4-5,7H2,1H3 |
| InChIKey | VREZRQGFADTZBR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|