C14H19N3O6S2 — CID 40588368
N-[(3R)-1,1-dioxothiolan-3-yl]-3-nitro-4-pyrrolidin-1-ylbenzenesulfonamide (PubChem CID 40588368) has the molecular formula C14H19N3O6S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-3-nitro-4-pyrrolidin-1-ylbenzenesulfonamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-3-nitro-4-pyrrolidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 40588368 |
| Molecular Formula | C14H19N3O6S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-3-nitro-4-pyrrolidin-1-ylbenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N[C@@H]2CCS(=O)(=O)C2)ccc1N1CCCC1 |
| InChI | InChI=1S/C14H19N3O6S2/c18-17(19)14-9-12(3-4-13(14)16-6-1-2-7-16)25(22,23)15-11-5-8-24(20,21)10-11/h3-4,9,11,15H,1-2,5-8,10H2/t11-/m1/s1 |
| InChIKey | BWZSVIRRRQDPQS-LLVKDONJSA-N |
| XLogP | 0.66 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|