C19H28N4O5S — CID 7550841
N-cycloheptyl-2-[(3-nitro-4-pyrrolidin-1-ylphenyl)sulfonylamino]acetamide (PubChem CID 7550841) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-cycloheptyl-2-[(3-nitro-4-pyrrolidin-1-ylphenyl)sulfonylamino]acetamide.
| Compound Name | N-cycloheptyl-2-[(3-nitro-4-pyrrolidin-1-ylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 7550841 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-cycloheptyl-2-[(3-nitro-4-pyrrolidin-1-ylphenyl)sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1)NC1CCCCCC1 |
| InChI | InChI=1S/C19H28N4O5S/c24-19(21-15-7-3-1-2-4-8-15)14-20-29(27,28)16-9-10-17(18(13-16)23(25)26)22-11-5-6-12-22/h9-10,13,15,20H,1-8,11-12,14H2,(H,21,24) |
| InChIKey | FQXGSVURQRLPTN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|