C14H20N4O5S — CID 9209200
N-cyclopentyl-2-[4-(methylsulfamoyl)-2-nitroanilino]acetamide (PubChem CID 9209200) has the molecular formula C14H20N4O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is N-cyclopentyl-2-[4-(methylsulfamoyl)-2-nitroanilino]acetamide.
| Compound Name | N-cyclopentyl-2-[4-(methylsulfamoyl)-2-nitroanilino]acetamide |
|---|---|
| PubChem CID | 9209200 |
| Molecular Formula | C14H20N4O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-cyclopentyl-2-[4-(methylsulfamoyl)-2-nitroanilino]acetamide |
| SMILES | CNS(=O)(=O)c1ccc(NCC(=O)NC2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H20N4O5S/c1-15-24(22,23)11-6-7-12(13(8-11)18(20)21)16-9-14(19)17-10-4-2-3-5-10/h6-8,10,15-16H,2-5,9H2,1H3,(H,17,19) |
| InChIKey | KCHVVVJOSXKBJO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|