C12H14N4O4 — CID 43400441
4-[[2-(cyclopropylamino)-2-oxoethyl]amino]-3-nitrobenzamide (PubChem CID 43400441) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 4-[[2-(cyclopropylamino)-2-oxoethyl]amino]-3-nitrobenzamide.
| Compound Name | 4-[[2-(cyclopropylamino)-2-oxoethyl]amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 43400441 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-[[2-(cyclopropylamino)-2-oxoethyl]amino]-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(NCC(=O)NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N4O4/c13-12(18)7-1-4-9(10(5-7)16(19)20)14-6-11(17)15-8-2-3-8/h1,4-5,8,14H,2-3,6H2,(H2,13,18)(H,15,17) |
| InChIKey | NTMOQRPNNKBOSC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|