C15H22N4O7S2 — CID 51954642
N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-nitro-4-(propan-2-ylsulfamoyl)anilino]acetamide (PubChem CID 51954642) has the molecular formula C15H22N4O7S2 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-nitro-4-(propan-2-ylsulfamoyl)anilino]acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-nitro-4-(propan-2-ylsulfamoyl)anilino]acetamide |
|---|---|
| PubChem CID | 51954642 |
| Molecular Formula | C15H22N4O7S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-nitro-4-(propan-2-ylsulfamoyl)anilino]acetamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NCC(=O)N[C@H]2CCS(=O)(=O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H22N4O7S2/c1-10(2)18-28(25,26)12-3-4-13(14(7-12)19(21)22)16-8-15(20)17-11-5-6-27(23,24)9-11/h3-4,7,10-11,16,18H,5-6,8-9H2,1-2H3,(H,17,20)/t11-/m0/s1 |
| InChIKey | LATGSGPUFMRYHG-NSHDSACASA-N |
| XLogP | -0.00 |
| TPSA | 164.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|