C13H14F3N3O5S2 — CID 7825396
N-[(3R)-1,1-dioxothiolan-3-yl]-2-[2-nitro-4-(trifluoromethylsulfanyl)anilino]acetamide (PubChem CID 7825396) has the molecular formula C13H14F3N3O5S2 and a molecular weight of 413.40 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-[2-nitro-4-(trifluoromethylsulfanyl)anilino]acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[2-nitro-4-(trifluoromethylsulfanyl)anilino]acetamide |
|---|---|
| PubChem CID | 7825396 |
| Molecular Formula | C13H14F3N3O5S2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[2-nitro-4-(trifluoromethylsulfanyl)anilino]acetamide |
| SMILES | O=C(CNc1ccc(SC(F)(F)F)cc1[N+](=O)[O-])N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14F3N3O5S2/c14-13(15,16)25-9-1-2-10(11(5-9)19(21)22)17-6-12(20)18-8-3-4-26(23,24)7-8/h1-2,5,8,17H,3-4,6-7H2,(H,18,20)/t8-/m1/s1 |
| InChIKey | MEEIDVFYMQTMAG-MRVPVSSYSA-N |
| XLogP | 1.92 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|