C15H14F7N3O7S2 — CID 5041903
N-(1,1-dioxothiolan-3-yl)-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitroanilino]acetamide (PubChem CID 5041903) has the molecular formula C15H14F7N3O7S2 and a molecular weight of 545.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitroanilino]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitroanilino]acetamide |
|---|---|
| PubChem CID | 5041903 |
| Molecular Formula | C15H14F7N3O7S2 |
| Molecular Weight | 545.41 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitroanilino]acetamide |
| SMILES | O=C(CNc1ccc(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1[N+](=O)[O-])NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H14F7N3O7S2/c16-13(17,14(18,19)20)15(21,22)34(31,32)9-1-2-10(11(5-9)25(27)28)23-6-12(26)24-8-3-4-33(29,30)7-8/h1-2,5,8,23H,3-4,6-7H2,(H,24,26) |
| InChIKey | JVBCESITOLANDZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 152.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|