C12H14N2O5S2 — CID 7371428
N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2-nitrophenyl)sulfanylacetamide (PubChem CID 7371428) has the molecular formula C12H14N2O5S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2-nitrophenyl)sulfanylacetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2-nitrophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7371428 |
| Molecular Formula | C12H14N2O5S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2-nitrophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccccc1[N+](=O)[O-])N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14N2O5S2/c15-12(13-9-5-6-21(18,19)8-9)7-20-11-4-2-1-3-10(11)14(16)17/h1-4,9H,5-8H2,(H,13,15)/t9-/m1/s1 |
| InChIKey | NFHUCEPKMFACGS-SECBINFHSA-N |
| XLogP | 0.99 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|