C13H16FNO3S2 — CID 47012967
N-(1,1-dioxothiolan-3-yl)-3-(2-fluorophenyl)sulfanylpropanamide (PubChem CID 47012967) has the molecular formula C13H16FNO3S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(2-fluorophenyl)sulfanylpropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(2-fluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 47012967 |
| Molecular Formula | C13H16FNO3S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(2-fluorophenyl)sulfanylpropanamide |
| SMILES | O=C(CCSc1ccccc1F)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16FNO3S2/c14-11-3-1-2-4-12(11)19-7-5-13(16)15-10-6-8-20(17,18)9-10/h1-4,10H,5-9H2,(H,15,16) |
| InChIKey | XSPFLWQUNCNIKM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |