C15H20FNO2S — CID 62358670
3-(2-fluorophenyl)sulfanyl-N-(2-hydroxycyclohexyl)propanamide (PubChem CID 62358670) has the molecular formula C15H20FNO2S and a molecular weight of 297.39 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfanyl-N-(2-hydroxycyclohexyl)propanamide.
| Compound Name | 3-(2-fluorophenyl)sulfanyl-N-(2-hydroxycyclohexyl)propanamide |
|---|---|
| PubChem CID | 62358670 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-(2-fluorophenyl)sulfanyl-N-(2-hydroxycyclohexyl)propanamide |
| SMILES | O=C(CCSc1ccccc1F)NC1CCCCC1O |
| InChI | InChI=1S/C15H20FNO2S/c16-11-5-1-4-8-14(11)20-10-9-15(19)17-12-6-2-3-7-13(12)18/h1,4-5,8,12-13,18H,2-3,6-7,9-10H2,(H,17,19) |
| InChIKey | APXWNQXYNINBKZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |