C15H18FNO3S — CID 64812300
2-[[2-(2-fluorophenyl)sulfanylacetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 64812300) has the molecular formula C15H18FNO3S and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[[2-(2-fluorophenyl)sulfanylacetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[[2-(2-fluorophenyl)sulfanylacetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 64812300 |
| Molecular Formula | C15H18FNO3S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-[[2-(2-fluorophenyl)sulfanylacetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CSc1ccccc1F)NC1CCCCC1C(=O)O |
| InChI | InChI=1S/C15H18FNO3S/c16-11-6-2-4-8-13(11)21-9-14(18)17-12-7-3-1-5-10(12)15(19)20/h2,4,6,8,10,12H,1,3,5,7,9H2,(H,17,18)(H,19,20) |
| InChIKey | GHILMJZNRSRYPU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |