C15H19FOS — CID 82931688
1-cycloheptyl-2-(2-fluorophenyl)sulfanylethanone (PubChem CID 82931688) has the molecular formula C15H19FOS and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-cycloheptyl-2-(2-fluorophenyl)sulfanylethanone.
| Compound Name | 1-cycloheptyl-2-(2-fluorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 82931688 |
| Molecular Formula | C15H19FOS |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-cycloheptyl-2-(2-fluorophenyl)sulfanylethanone |
| SMILES | O=C(CSc1ccccc1F)C1CCCCCC1 |
| InChI | InChI=1S/C15H19FOS/c16-13-9-5-6-10-15(13)18-11-14(17)12-7-3-1-2-4-8-12/h5-6,9-10,12H,1-4,7-8,11H2 |
| InChIKey | SSTQKFPJJONZQA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |