C15H17FN2O2S — CID 26785346
(1S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]cyclohex-3-ene-1-carbohydrazide (PubChem CID 26785346) has the molecular formula C15H17FN2O2S and a molecular weight of 308.38 g/mol. Its IUPAC name is (1S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]cyclohex-3-ene-1-carbohydrazide.
| Compound Name | (1S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]cyclohex-3-ene-1-carbohydrazide |
|---|---|
| PubChem CID | 26785346 |
| Molecular Formula | C15H17FN2O2S |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (1S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]cyclohex-3-ene-1-carbohydrazide |
| SMILES | O=C(CSc1ccccc1F)NNC(=O)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C15H17FN2O2S/c16-12-8-4-5-9-13(12)21-10-14(19)17-18-15(20)11-6-2-1-3-7-11/h1-2,4-5,8-9,11H,3,6-7,10H2,(H,17,19)(H,18,20)/t11-/m1/s1 |
| InChIKey | LQTIQNCKNUDZJU-LLVKDONJSA-N |
| XLogP | 2.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|