C17H21FN2O2S — CID 11919710
2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-fluorophenyl)sulfanylacetyl]acetohydrazide (PubChem CID 11919710) has the molecular formula C17H21FN2O2S and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-fluorophenyl)sulfanylacetyl]acetohydrazide.
| Compound Name | 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-fluorophenyl)sulfanylacetyl]acetohydrazide |
|---|---|
| PubChem CID | 11919710 |
| Molecular Formula | C17H21FN2O2S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-fluorophenyl)sulfanylacetyl]acetohydrazide |
| SMILES | O=C(CSc1ccccc1F)NNC(=O)C[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C17H21FN2O2S/c18-14-3-1-2-4-15(14)23-10-17(22)20-19-16(21)9-13-8-11-5-6-12(13)7-11/h1-4,11-13H,5-10H2,(H,19,21)(H,20,22)/t11-,12+,13+/m0/s1 |
| InChIKey | ZOBJIHFLBQCNQK-YNEHKIRRSA-N |
| XLogP | 2.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|