C18H24N2O2S — CID 18557265
2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(4-methylphenyl)sulfanylacetyl]acetohydrazide (PubChem CID 18557265) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(4-methylphenyl)sulfanylacetyl]acetohydrazide.
| Compound Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(4-methylphenyl)sulfanylacetyl]acetohydrazide |
|---|---|
| PubChem CID | 18557265 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(4-methylphenyl)sulfanylacetyl]acetohydrazide |
| SMILES | Cc1ccc(SCC(=O)NNC(=O)C[C@H]2C[C@@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C18H24N2O2S/c1-12-2-6-16(7-3-12)23-11-18(22)20-19-17(21)10-15-9-13-4-5-14(15)8-13/h2-3,6-7,13-15H,4-5,8-11H2,1H3,(H,19,21)(H,20,22)/t13-,14-,15-/m1/s1 |
| InChIKey | IGFLUYOAORCNET-RBSFLKMASA-N |
| XLogP | 3.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|