C17H22ClNOS — CID 9258804
2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide (PubChem CID 9258804) has the molecular formula C17H22ClNOS and a molecular weight of 323.89 g/mol. Its IUPAC name is 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide.
| Compound Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 9258804 |
| Molecular Formula | C17H22ClNOS |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide |
| SMILES | O=C(C[C@@H]1C[C@H]2CC[C@H]1C2)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClNOS/c18-15-3-5-16(6-4-15)21-8-7-19-17(20)11-14-10-12-1-2-13(14)9-12/h3-6,12-14H,1-2,7-11H2,(H,19,20)/t12-,13-,14-/m0/s1 |
| InChIKey | JOHFZOYVWPADRV-IHRRRGAJSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|