C16H20ClNOS — CID 98613749
(1S,2R,4S)-N-[2-(4-chlorophenyl)sulfanylethyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 98613749) has the molecular formula C16H20ClNOS and a molecular weight of 309.86 g/mol. Its IUPAC name is (1S,2R,4S)-N-[2-(4-chlorophenyl)sulfanylethyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2R,4S)-N-[2-(4-chlorophenyl)sulfanylethyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 98613749 |
| Molecular Formula | C16H20ClNOS |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (1S,2R,4S)-N-[2-(4-chlorophenyl)sulfanylethyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NCCSc1ccc(Cl)cc1)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H20ClNOS/c17-13-3-5-14(6-4-13)20-8-7-18-16(19)15-10-11-1-2-12(15)9-11/h3-6,11-12,15H,1-2,7-10H2,(H,18,19)/t11-,12-,15+/m0/s1 |
| InChIKey | MIQYUIYBGONIGV-SLEUVZQESA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|