C18H24ClN3OS — CID 11946482
1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-[2-(4-chlorophenyl)ethyl]thiourea (PubChem CID 11946482) has the molecular formula C18H24ClN3OS and a molecular weight of 365.93 g/mol. Its IUPAC name is 1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-[2-(4-chlorophenyl)ethyl]thiourea.
| Compound Name | 1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-[2-(4-chlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 11946482 |
| Molecular Formula | C18H24ClN3OS |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-[2-(4-chlorophenyl)ethyl]thiourea |
| SMILES | O=C(C[C@H]1C[C@H]2CC[C@@H]1C2)NNC(=S)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClN3OS/c19-16-5-2-12(3-6-16)7-8-20-18(24)22-21-17(23)11-15-10-13-1-4-14(15)9-13/h2-3,5-6,13-15H,1,4,7-11H2,(H,21,23)(H2,20,22,24)/t13-,14+,15+/m0/s1 |
| InChIKey | KRZAGAUFDJWIQD-RRFJBIMHSA-N |
| XLogP | 3.20 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|