C17H22FN3OS — CID 11935009
1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 11935009) has the molecular formula C17H22FN3OS and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 11935009 |
| Molecular Formula | C17H22FN3OS |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | O=C(C[C@H]1C[C@H]2CC[C@@H]1C2)NNC(=S)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FN3OS/c18-15-5-2-11(3-6-15)10-19-17(23)21-20-16(22)9-14-8-12-1-4-13(14)7-12/h2-3,5-6,12-14H,1,4,7-10H2,(H,20,22)(H2,19,21,23)/t12-,13+,14+/m0/s1 |
| InChIKey | OPLDUAKDLCQABP-BFHYXJOUSA-N |
| XLogP | 2.65 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|