C19H23N3O2 — CID 51166897
2-(2-bicyclo[2.2.1]heptanyl)-N'-[2-(1H-indol-3-yl)acetyl]acetohydrazide (PubChem CID 51166897) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N'-[2-(1H-indol-3-yl)acetyl]acetohydrazide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N'-[2-(1H-indol-3-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 51166897 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N'-[2-(1H-indol-3-yl)acetyl]acetohydrazide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NNC(=O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C19H23N3O2/c23-18(9-14-8-12-5-6-13(14)7-12)21-22-19(24)10-15-11-20-17-4-2-1-3-16(15)17/h1-4,11-14,20H,5-10H2,(H,21,23)(H,22,24) |
| InChIKey | OKBVGUGGPBQJAG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|