C18H20N2O — CID 103767102
2-(1H-indol-3-yl)-N-(3-tricyclo[3.2.1.02,4]octanyl)acetamide (PubChem CID 103767102) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-(3-tricyclo[3.2.1.02,4]octanyl)acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-(3-tricyclo[3.2.1.02,4]octanyl)acetamide |
|---|---|
| PubChem CID | 103767102 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-(3-tricyclo[3.2.1.02,4]octanyl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C18H20N2O/c21-15(8-12-9-19-14-4-2-1-3-13(12)14)20-18-16-10-5-6-11(7-10)17(16)18/h1-4,9-11,16-19H,5-8H2,(H,20,21) |
| InChIKey | ZVFYGLWDCRJCKG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |