C16H21N3O3 — CID 21174904
2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide (PubChem CID 21174904) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide.
| Compound Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 21174904 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide |
| SMILES | O=C(C[C@H]1C[C@@H]2CC[C@@H]1C2)NNC(=O)Cn1ccccc1=O |
| InChI | InChI=1S/C16H21N3O3/c20-14(9-13-8-11-4-5-12(13)7-11)17-18-15(21)10-19-6-2-1-3-16(19)22/h1-3,6,11-13H,4-5,7-10H2,(H,17,20)(H,18,21)/t11-,12-,13-/m1/s1 |
| InChIKey | YBJLJSPHKUNHLM-JHJVBQTASA-N |
| XLogP | 0.82 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|