C19H22N4O2 — CID 24540990
N'-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 24540990) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N'-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24540990 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N'-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(CC1CC2CCC1C2)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H22N4O2/c24-18(10-15-9-12-6-7-14(15)8-12)22-23-19(25)17-11-16(20-21-17)13-4-2-1-3-5-13/h1-5,11-12,14-15H,6-10H2,(H,20,21)(H,22,24)(H,23,25) |
| InChIKey | AGHVJNOFMOODEO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|