C24H28N2O4 — CID 11944432
N'-[2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-2-(2-phenoxyethoxy)benzohydrazide (PubChem CID 11944432) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N'-[2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-2-(2-phenoxyethoxy)benzohydrazide.
| Compound Name | N'-[2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-2-(2-phenoxyethoxy)benzohydrazide |
|---|---|
| PubChem CID | 11944432 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N'-[2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-2-(2-phenoxyethoxy)benzohydrazide |
| SMILES | O=C(C[C@@H]1C[C@H]2CC[C@@H]1C2)NNC(=O)c1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C24H28N2O4/c27-23(16-19-15-17-10-11-18(19)14-17)25-26-24(28)21-8-4-5-9-22(21)30-13-12-29-20-6-2-1-3-7-20/h1-9,17-19H,10-16H2,(H,25,27)(H,26,28)/t17-,18+,19-/m0/s1 |
| InChIKey | RRBSGBHZSVVYIX-OTWHNJEPSA-N |
| XLogP | 3.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|