C18H21BrN2O4 — CID 11916727
[2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 11916727) has the molecular formula C18H21BrN2O4 and a molecular weight of 409.28 g/mol. Its IUPAC name is [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 11916727 |
| Molecular Formula | C18H21BrN2O4 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | O=C(COC(=O)C[C@@H]1C[C@H]2CC[C@@H]1C2)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C18H21BrN2O4/c19-15-4-2-1-3-14(15)18(24)21-20-16(22)10-25-17(23)9-13-8-11-5-6-12(13)7-11/h1-4,11-13H,5-10H2,(H,20,22)(H,21,24)/t11-,12+,13-/m0/s1 |
| InChIKey | CMBWQLZGXSBANS-XQQFMLRXSA-N |
| XLogP | 2.58 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|