C16H20N2O5 — CID 21174446
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 21174446) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 21174446 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | O=C(COC(=O)C[C@H]1C[C@@H]2CC[C@@H]1C2)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H20N2O5/c19-14(17-18-16(21)13-2-1-5-22-13)9-23-15(20)8-12-7-10-3-4-11(12)6-10/h1-2,5,10-12H,3-4,6-9H2,(H,17,19)(H,18,21)/t10-,11-,12-/m1/s1 |
| InChIKey | JYLQRVCZUKTZMV-IJLUTSLNSA-N |
| XLogP | 1.41 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|